C12H18N4O — CID 113449876
2-N-(2-propan-2-yloxyethyl)-3H-benzimidazole-2,5-diamine (PubChem CID 113449876) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-N-(2-propan-2-yloxyethyl)-3H-benzimidazole-2,5-diamine.
| Compound Name | 2-N-(2-propan-2-yloxyethyl)-3H-benzimidazole-2,5-diamine |
|---|---|
| PubChem CID | 113449876 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-N-(2-propan-2-yloxyethyl)-3H-benzimidazole-2,5-diamine |
| SMILES | CC(C)OCCNc1nc2ccc(N)cc2[nH]1 |
| InChI | InChI=1S/C12H18N4O/c1-8(2)17-6-5-14-12-15-10-4-3-9(13)7-11(10)16-12/h3-4,7-8H,5-6,13H2,1-2H3,(H2,14,15,16) |
| InChIKey | CYLSBZSFUQYPLX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|