C13H18N4O2 — CID 104758986
2-N-[(3-methoxyoxolan-3-yl)methyl]-3H-benzimidazole-2,5-diamine (PubChem CID 104758986) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-N-[(3-methoxyoxolan-3-yl)methyl]-3H-benzimidazole-2,5-diamine.
| Compound Name | 2-N-[(3-methoxyoxolan-3-yl)methyl]-3H-benzimidazole-2,5-diamine |
|---|---|
| PubChem CID | 104758986 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-N-[(3-methoxyoxolan-3-yl)methyl]-3H-benzimidazole-2,5-diamine |
| SMILES | COC1(CNc2nc3ccc(N)cc3[nH]2)CCOC1 |
| InChI | InChI=1S/C13H18N4O2/c1-18-13(4-5-19-8-13)7-15-12-16-10-3-2-9(14)6-11(10)17-12/h2-3,6H,4-5,7-8,14H2,1H3,(H2,15,16,17) |
| InChIKey | MABSHNGXDCGNQJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|