C13H15ClN2O2S — CID 104763243
6-chloro-N-[(3-methoxyoxolan-3-yl)methyl]-1,3-benzothiazol-2-amine (PubChem CID 104763243) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.79 g/mol. Its IUPAC name is 6-chloro-N-[(3-methoxyoxolan-3-yl)methyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-[(3-methoxyoxolan-3-yl)methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 104763243 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 6-chloro-N-[(3-methoxyoxolan-3-yl)methyl]-1,3-benzothiazol-2-amine |
| SMILES | COC1(CNc2nc3ccc(Cl)cc3s2)CCOC1 |
| InChI | InChI=1S/C13H15ClN2O2S/c1-17-13(4-5-18-8-13)7-15-12-16-10-3-2-9(14)6-11(10)19-12/h2-3,6H,4-5,7-8H2,1H3,(H,15,16) |
| InChIKey | HNKHLBURYLRQJR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |