C13H15BrN2O2 — CID 104705560
5-bromo-2-[(3-methoxyoxolan-3-yl)methylamino]benzonitrile (PubChem CID 104705560) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is 5-bromo-2-[(3-methoxyoxolan-3-yl)methylamino]benzonitrile.
| Compound Name | 5-bromo-2-[(3-methoxyoxolan-3-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 104705560 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 5-bromo-2-[(3-methoxyoxolan-3-yl)methylamino]benzonitrile |
| SMILES | COC1(CNc2ccc(Br)cc2C#N)CCOC1 |
| InChI | InChI=1S/C13H15BrN2O2/c1-17-13(4-5-18-9-13)8-16-12-3-2-11(14)6-10(12)7-15/h2-3,6,16H,4-5,8-9H2,1H3 |
| InChIKey | WKGIHLNAQVGHBO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |