C14H16BrN3O2 — CID 104762658
7-bromo-N-[(3-methoxyoxolan-3-yl)methyl]-1,5-naphthyridin-4-amine (PubChem CID 104762658) has the molecular formula C14H16BrN3O2 and a molecular weight of 338.20 g/mol. Its IUPAC name is 7-bromo-N-[(3-methoxyoxolan-3-yl)methyl]-1,5-naphthyridin-4-amine.
| Compound Name | 7-bromo-N-[(3-methoxyoxolan-3-yl)methyl]-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 104762658 |
| Molecular Formula | C14H16BrN3O2 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 7-bromo-N-[(3-methoxyoxolan-3-yl)methyl]-1,5-naphthyridin-4-amine |
| SMILES | COC1(CNc2ccnc3cc(Br)cnc23)CCOC1 |
| InChI | InChI=1S/C14H16BrN3O2/c1-19-14(3-5-20-9-14)8-18-11-2-4-16-12-6-10(15)7-17-13(11)12/h2,4,6-7H,3,5,8-9H2,1H3,(H,16,18) |
| InChIKey | RRKUGFULICMLAX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |