C18H18BrN3O2 — CID 133481963
7-bromo-N-[[4-(2-methoxyethoxy)phenyl]methyl]-1,5-naphthyridin-4-amine (PubChem CID 133481963) has the molecular formula C18H18BrN3O2 and a molecular weight of 388.27 g/mol. Its IUPAC name is 7-bromo-N-[[4-(2-methoxyethoxy)phenyl]methyl]-1,5-naphthyridin-4-amine.
| Compound Name | 7-bromo-N-[[4-(2-methoxyethoxy)phenyl]methyl]-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 133481963 |
| Molecular Formula | C18H18BrN3O2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 7-bromo-N-[[4-(2-methoxyethoxy)phenyl]methyl]-1,5-naphthyridin-4-amine |
| SMILES | COCCOc1ccc(CNc2ccnc3cc(Br)cnc23)cc1 |
| InChI | InChI=1S/C18H18BrN3O2/c1-23-8-9-24-15-4-2-13(3-5-15)11-21-16-6-7-20-17-10-14(19)12-22-18(16)17/h2-7,10,12H,8-9,11H2,1H3,(H,20,21) |
| InChIKey | SONOULAYHCUAKF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|