C14H19BrN4O — CID 104891853
7-bromo-N-[2-[2-(dimethylamino)ethoxy]ethyl]-1,5-naphthyridin-4-amine (PubChem CID 104891853) has the molecular formula C14H19BrN4O and a molecular weight of 339.24 g/mol. Its IUPAC name is 7-bromo-N-[2-[2-(dimethylamino)ethoxy]ethyl]-1,5-naphthyridin-4-amine.
| Compound Name | 7-bromo-N-[2-[2-(dimethylamino)ethoxy]ethyl]-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 104891853 |
| Molecular Formula | C14H19BrN4O |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 7-bromo-N-[2-[2-(dimethylamino)ethoxy]ethyl]-1,5-naphthyridin-4-amine |
| SMILES | CN(C)CCOCCNc1ccnc2cc(Br)cnc12 |
| InChI | InChI=1S/C14H19BrN4O/c1-19(2)6-8-20-7-5-17-12-3-4-16-13-9-11(15)10-18-14(12)13/h3-4,9-10H,5-8H2,1-2H3,(H,16,17) |
| InChIKey | SSFRJHIHJIKJIW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|