C14H16BrF3N4 — CID 133482029
N-(7-bromo-1,5-naphthyridin-4-yl)-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine (PubChem CID 133482029) has the molecular formula C14H16BrF3N4 and a molecular weight of 377.21 g/mol. Its IUPAC name is N-(7-bromo-1,5-naphthyridin-4-yl)-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine.
| Compound Name | N-(7-bromo-1,5-naphthyridin-4-yl)-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 133482029 |
| Molecular Formula | C14H16BrF3N4 |
| Molecular Weight | 377.21 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | N-(7-bromo-1,5-naphthyridin-4-yl)-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine |
| SMILES | CN(CCCNc1ccnc2cc(Br)cnc12)CC(F)(F)F |
| InChI | InChI=1S/C14H16BrF3N4/c1-22(9-14(16,17)18)6-2-4-19-11-3-5-20-12-7-10(15)8-21-13(11)12/h3,5,7-8H,2,4,6,9H2,1H3,(H,19,20) |
| InChIKey | CRIRPSMKUGNUGX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|