C12H13BrN4O2 — CID 67052452
7-bromo-N-(2-methyl-3-nitropropyl)-1,5-naphthyridin-4-amine (PubChem CID 67052452) has the molecular formula C12H13BrN4O2 and a molecular weight of 325.17 g/mol. Its IUPAC name is 7-bromo-N-(2-methyl-3-nitropropyl)-1,5-naphthyridin-4-amine.
| Compound Name | 7-bromo-N-(2-methyl-3-nitropropyl)-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 67052452 |
| Molecular Formula | C12H13BrN4O2 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 7-bromo-N-(2-methyl-3-nitropropyl)-1,5-naphthyridin-4-amine |
| SMILES | CC(CNc1ccnc2cc(Br)cnc12)C[N+](=O)[O-] |
| InChI | InChI=1S/C12H13BrN4O2/c1-8(7-17(18)19)5-15-10-2-3-14-11-4-9(13)6-16-12(10)11/h2-4,6,8H,5,7H2,1H3,(H,14,15) |
| InChIKey | HZFYFFNMIUXYON-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|