C17H16BrN3O2S — CID 133465726
7-bromo-N-[(4-ethylsulfonylphenyl)methyl]-1,5-naphthyridin-4-amine (PubChem CID 133465726) has the molecular formula C17H16BrN3O2S and a molecular weight of 406.31 g/mol. Its IUPAC name is 7-bromo-N-[(4-ethylsulfonylphenyl)methyl]-1,5-naphthyridin-4-amine.
| Compound Name | 7-bromo-N-[(4-ethylsulfonylphenyl)methyl]-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 133465726 |
| Molecular Formula | C17H16BrN3O2S |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 7-bromo-N-[(4-ethylsulfonylphenyl)methyl]-1,5-naphthyridin-4-amine |
| SMILES | CCS(=O)(=O)c1ccc(CNc2ccnc3cc(Br)cnc23)cc1 |
| InChI | InChI=1S/C17H16BrN3O2S/c1-2-24(22,23)14-5-3-12(4-6-14)10-20-15-7-8-19-16-9-13(18)11-21-17(15)16/h3-9,11H,2,10H2,1H3,(H,19,20) |
| InChIKey | OFVQJVKREDQJDX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |