C11H15FN2O2 — CID 104764554
2-fluoro-N-[(3-methoxyoxolan-3-yl)methyl]pyridin-4-amine (PubChem CID 104764554) has the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. Its IUPAC name is 2-fluoro-N-[(3-methoxyoxolan-3-yl)methyl]pyridin-4-amine.
| Compound Name | 2-fluoro-N-[(3-methoxyoxolan-3-yl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 104764554 |
| Molecular Formula | C11H15FN2O2 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-fluoro-N-[(3-methoxyoxolan-3-yl)methyl]pyridin-4-amine |
| SMILES | COC1(CNc2ccnc(F)c2)CCOC1 |
| InChI | InChI=1S/C11H15FN2O2/c1-15-11(3-5-16-8-11)7-14-9-2-4-13-10(12)6-9/h2,4,6H,3,5,7-8H2,1H3,(H,13,14) |
| InChIKey | CWXMHSMBFPYUNA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|