C13H20N2O3 — CID 104758953
4-methoxy-1-N-[(3-methoxyoxolan-3-yl)methyl]benzene-1,2-diamine (PubChem CID 104758953) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 4-methoxy-1-N-[(3-methoxyoxolan-3-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4-methoxy-1-N-[(3-methoxyoxolan-3-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 104758953 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 4-methoxy-1-N-[(3-methoxyoxolan-3-yl)methyl]benzene-1,2-diamine |
| SMILES | COc1ccc(NCC2(OC)CCOC2)c(N)c1 |
| InChI | InChI=1S/C13H20N2O3/c1-16-10-3-4-12(11(14)7-10)15-8-13(17-2)5-6-18-9-13/h3-4,7,15H,5-6,8-9,14H2,1-2H3 |
| InChIKey | DEKPWQVNZZWUEF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|