C10H12N3OP — CID 91057864
N-ethyl-6-methylidenephosphanyloxy-1H-benzimidazol-2-amine (PubChem CID 91057864) has the molecular formula C10H12N3OP and a molecular weight of 221.20 g/mol. Its IUPAC name is N-ethyl-6-methylidenephosphanyloxy-1H-benzimidazol-2-amine.
| Compound Name | N-ethyl-6-methylidenephosphanyloxy-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 91057864 |
| Molecular Formula | C10H12N3OP |
| Molecular Weight | 221.20 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | N-ethyl-6-methylidenephosphanyloxy-1H-benzimidazol-2-amine |
| SMILES | C=POc1ccc2nc(NCC)[nH]c2c1 |
| InChI | InChI=1S/C10H12N3OP/c1-3-11-10-12-8-5-4-7(14-15-2)6-9(8)13-10/h4-6H,2-3H2,1H3,(H2,11,12,13) |
| InChIKey | HMOHXAJNJWWQEV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|