C15H22N4O2 — CID 15425062
tert-butyl N-[3-(1H-benzimidazol-2-ylamino)propyl]carbamate (PubChem CID 15425062) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is tert-butyl N-[3-(1H-benzimidazol-2-ylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(1H-benzimidazol-2-ylamino)propyl]carbamate |
|---|---|
| PubChem CID | 15425062 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | tert-butyl N-[3-(1H-benzimidazol-2-ylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H22N4O2/c1-15(2,3)21-14(20)17-10-6-9-16-13-18-11-7-4-5-8-12(11)19-13/h4-5,7-8H,6,9-10H2,1-3H3,(H,17,20)(H2,16,18,19) |
| InChIKey | MQKQZAZHVYQTSH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|