C8H10N3O3P — CID 57013853
(1H-benzimidazol-2-ylamino)methylphosphonic acid (PubChem CID 57013853) has the molecular formula C8H10N3O3P and a molecular weight of 227.16 g/mol. Its IUPAC name is (1H-benzimidazol-2-ylamino)methylphosphonic acid.
| Compound Name | (1H-benzimidazol-2-ylamino)methylphosphonic acid |
|---|---|
| PubChem CID | 57013853 |
| Molecular Formula | C8H10N3O3P |
| Molecular Weight | 227.16 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | (1H-benzimidazol-2-ylamino)methylphosphonic acid |
| SMILES | O=P(O)(O)CNc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C8H10N3O3P/c12-15(13,14)5-9-8-10-6-3-1-2-4-7(6)11-8/h1-4H,5H2,(H2,9,10,11)(H2,12,13,14) |
| InChIKey | PYIVORIDQCOEOV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.16 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|