C22H20N6 — CID 101271136
N-[[3-[(1H-benzimidazol-2-ylamino)methyl]phenyl]methyl]-1H-benzimidazol-2-amine (PubChem CID 101271136) has the molecular formula C22H20N6 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-[[3-[(1H-benzimidazol-2-ylamino)methyl]phenyl]methyl]-1H-benzimidazol-2-amine.
| Compound Name | N-[[3-[(1H-benzimidazol-2-ylamino)methyl]phenyl]methyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 101271136 |
| Molecular Formula | C22H20N6 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[[3-[(1H-benzimidazol-2-ylamino)methyl]phenyl]methyl]-1H-benzimidazol-2-amine |
| SMILES | c1cc(CNc2nc3ccccc3[nH]2)cc(CNc2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C22H20N6/c1-2-9-18-17(8-1)25-21(26-18)23-13-15-6-5-7-16(12-15)14-24-22-27-19-10-3-4-11-20(19)28-22/h1-12H,13-14H2,(H2,23,25,26)(H2,24,27,28) |
| InChIKey | FMDQETSWWZWCKV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |