C11H10N4S — CID 141189433
N-(1,2-thiazol-5-ylmethyl)-1H-benzimidazol-2-amine (PubChem CID 141189433) has the molecular formula C11H10N4S and a molecular weight of 230.30 g/mol. Its IUPAC name is N-(1,2-thiazol-5-ylmethyl)-1H-benzimidazol-2-amine.
| Compound Name | N-(1,2-thiazol-5-ylmethyl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 141189433 |
| Molecular Formula | C11H10N4S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | N-(1,2-thiazol-5-ylmethyl)-1H-benzimidazol-2-amine |
| SMILES | c1ccc2[nH]c(NCc3ccns3)nc2c1 |
| InChI | InChI=1S/C11H10N4S/c1-2-4-10-9(3-1)14-11(15-10)12-7-8-5-6-13-16-8/h1-6H,7H2,(H2,12,14,15) |
| InChIKey | SVPNQFNEATWVIM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |