C15H13F2N3 — CID 154703945
N-[[2-(difluoromethyl)phenyl]methyl]-1H-benzimidazol-2-amine (PubChem CID 154703945) has the molecular formula C15H13F2N3 and a molecular weight of 273.29 g/mol. Its IUPAC name is N-[[2-(difluoromethyl)phenyl]methyl]-1H-benzimidazol-2-amine.
| Compound Name | N-[[2-(difluoromethyl)phenyl]methyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 154703945 |
| Molecular Formula | C15H13F2N3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[[2-(difluoromethyl)phenyl]methyl]-1H-benzimidazol-2-amine |
| SMILES | FC(F)c1ccccc1CNc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H13F2N3/c16-14(17)11-6-2-1-5-10(11)9-18-15-19-12-7-3-4-8-13(12)20-15/h1-8,14H,9H2,(H2,18,19,20) |
| InChIKey | QZIMSYGUIFUEBW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |