C11H10N4OS — CID 106382164
4-[(1H-benzimidazol-2-ylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106382164) has the molecular formula C11H10N4OS and a molecular weight of 246.30 g/mol. Its IUPAC name is 4-[(1H-benzimidazol-2-ylamino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(1H-benzimidazol-2-ylamino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106382164 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 4-[(1H-benzimidazol-2-ylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNc2nc3ccccc3[nH]2)cs1 |
| InChI | InChI=1S/C11H10N4OS/c16-11-13-7(6-17-11)5-12-10-14-8-3-1-2-4-9(8)15-10/h1-4,6H,5H2,(H,13,16)(H2,12,14,15) |
| InChIKey | RTMGQMFXLDWLBB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |