C19H15FN4O — CID 133409971
N-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-1H-benzimidazol-2-amine (PubChem CID 133409971) has the molecular formula C19H15FN4O and a molecular weight of 334.35 g/mol. Its IUPAC name is N-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-1H-benzimidazol-2-amine.
| Compound Name | N-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 133409971 |
| Molecular Formula | C19H15FN4O |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-1H-benzimidazol-2-amine |
| SMILES | Fc1ccc(Oc2cc(CNc3nc4ccccc4[nH]3)ccn2)cc1 |
| InChI | InChI=1S/C19H15FN4O/c20-14-5-7-15(8-6-14)25-18-11-13(9-10-21-18)12-22-19-23-16-3-1-2-4-17(16)24-19/h1-11H,12H2,(H2,22,23,24) |
| InChIKey | NXZJLKNLFHHHCO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |