C21H15F3N4O — CID 56574277
2-(difluoromethyl)-N-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]quinazolin-4-amine (PubChem CID 56574277) has the molecular formula C21H15F3N4O and a molecular weight of 396.37 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]quinazolin-4-amine.
| Compound Name | 2-(difluoromethyl)-N-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 56574277 |
| Molecular Formula | C21H15F3N4O |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 2-(difluoromethyl)-N-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]quinazolin-4-amine |
| SMILES | Fc1ccc(Oc2cc(CNc3nc(C(F)F)nc4ccccc34)ccn2)cc1 |
| InChI | InChI=1S/C21H15F3N4O/c22-14-5-7-15(8-6-14)29-18-11-13(9-10-25-18)12-26-20-16-3-1-2-4-17(16)27-21(28-20)19(23)24/h1-11,19H,12H2,(H,26,27,28) |
| InChIKey | OUJQLVQQMQIUKD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |