C17H15F2N3 — CID 56553646
2-(difluoromethyl)-N-[(4-methylphenyl)methyl]quinazolin-4-amine (PubChem CID 56553646) has the molecular formula C17H15F2N3 and a molecular weight of 299.32 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-[(4-methylphenyl)methyl]quinazolin-4-amine.
| Compound Name | 2-(difluoromethyl)-N-[(4-methylphenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 56553646 |
| Molecular Formula | C17H15F2N3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-(difluoromethyl)-N-[(4-methylphenyl)methyl]quinazolin-4-amine |
| SMILES | Cc1ccc(CNc2nc(C(F)F)nc3ccccc23)cc1 |
| InChI | InChI=1S/C17H15F2N3/c1-11-6-8-12(9-7-11)10-20-16-13-4-2-3-5-14(13)21-17(22-16)15(18)19/h2-9,15H,10H2,1H3,(H,20,21,22) |
| InChIKey | CPIJPSUCQMZIJH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |