C24H22N4O2 — CID 71690791
methyl 4-[[4-[(4-methylphenyl)methylamino]quinazolin-2-yl]amino]benzoate (PubChem CID 71690791) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is methyl 4-[[4-[(4-methylphenyl)methylamino]quinazolin-2-yl]amino]benzoate.
| Compound Name | methyl 4-[[4-[(4-methylphenyl)methylamino]quinazolin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 71690791 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | methyl 4-[[4-[(4-methylphenyl)methylamino]quinazolin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2nc(NCc3ccc(C)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C24H22N4O2/c1-16-7-9-17(10-8-16)15-25-22-20-5-3-4-6-21(20)27-24(28-22)26-19-13-11-18(12-14-19)23(29)30-2/h3-14H,15H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | KIVFIOMZTYJKCF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |