C23H22FN5 — CID 91963396
2-N-[4-(dimethylamino)phenyl]-4-N-[(4-fluorophenyl)methyl]quinazoline-2,4-diamine (PubChem CID 91963396) has the molecular formula C23H22FN5 and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-N-[4-(dimethylamino)phenyl]-4-N-[(4-fluorophenyl)methyl]quinazoline-2,4-diamine.
| Compound Name | 2-N-[4-(dimethylamino)phenyl]-4-N-[(4-fluorophenyl)methyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 91963396 |
| Molecular Formula | C23H22FN5 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 2-N-[4-(dimethylamino)phenyl]-4-N-[(4-fluorophenyl)methyl]quinazoline-2,4-diamine |
| SMILES | CN(C)c1ccc(Nc2nc(NCc3ccc(F)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C23H22FN5/c1-29(2)19-13-11-18(12-14-19)26-23-27-21-6-4-3-5-20(21)22(28-23)25-15-16-7-9-17(24)10-8-16/h3-14H,15H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | LNYBZAMOKCETJG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|