About 2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride
2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride (PubChem CID 146065336) has the molecular formula C15H14ClFN4
and a molecular weight of 304.76 g/mol. Its IUPAC name is 2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride |
| PubChem CID | 146065336 |
| Molecular Formula | C15H14ClFN4 |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride |
| SMILES | CNc1nc(Nc2ccc(F)cc2)nc2ccccc12.Cl |
| InChI | InChI=1S/C15H13FN4.ClH/c1-17-14-12-4-2-3-5-13(12)19-15(20-14)18-11-8-6-10(16)7-9-11;/h2-9H,1H3,(H2,17,18,19,20);1H |
| InChIKey | MQUFIUNPXNYDQS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride?
The IUPAC name of 2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride (CID 146065336) is 2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride.
What is the SMILES notation for 2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride?
The canonical SMILES for 2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride is CNc1nc(Nc2ccc(F)cc2)nc2ccccc12.Cl.
What is the InChIKey of 2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride?
The InChIKey is MQUFIUNPXNYDQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FN4.ClH/c1-17-14-12-4-2-3-5-13(12)19-15(20-14)18-11-8-6-10(16)7-9-11;/h2-9H,1H3,(H2,17,18,19,20);1H.
What are the key properties of 2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride?
2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride has a molecular weight of 304.76 g/mol, XLogP of 3.98, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(4-fluorophenyl)-4-N-methylquinazoline-2,4-diamine;hydrochloride is sourced from PubChem (CID 146065336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).