About 2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride
2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride (PubChem CID 67720832) has the molecular formula C20H16Cl2N4
and a molecular weight of 383.28 g/mol. Its IUPAC name is 2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride |
| PubChem CID | 67720832 |
| Molecular Formula | C20H16Cl2N4 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride |
| SMILES | Cl.Clc1ccc(Nc2nc(Nc3ccccc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C20H15ClN4.ClH/c21-14-10-12-16(13-11-14)23-20-24-18-9-5-4-8-17(18)19(25-20)22-15-6-2-1-3-7-15;/h1-13H,(H2,22,23,24,25);1H |
| InChIKey | BCMLGSRWMXUHSG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride?
The IUPAC name of 2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride (CID 67720832) is 2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride.
What is the SMILES notation for 2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride?
The canonical SMILES for 2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride is Cl.Clc1ccc(Nc2nc(Nc3ccccc3)c3ccccc3n2)cc1.
What is the InChIKey of 2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride?
The InChIKey is BCMLGSRWMXUHSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClN4.ClH/c21-14-10-12-16(13-11-14)23-20-24-18-9-5-4-8-17(18)19(25-20)22-15-6-2-1-3-7-15;/h1-13H,(H2,22,23,24,25);1H.
What are the key properties of 2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride?
2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride has a molecular weight of 383.28 g/mol, XLogP of 6.19, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(4-chlorophenyl)-4-N-phenylquinazoline-2,4-diamine;hydrochloride is sourced from PubChem (CID 67720832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).