C20H24ClN5 — CID 12703241
2-N-(4-chlorophenyl)-4-N-[2-(diethylamino)ethyl]quinazoline-2,4-diamine (PubChem CID 12703241) has the molecular formula C20H24ClN5 and a molecular weight of 369.90 g/mol. Its IUPAC name is 2-N-(4-chlorophenyl)-4-N-[2-(diethylamino)ethyl]quinazoline-2,4-diamine.
| Compound Name | 2-N-(4-chlorophenyl)-4-N-[2-(diethylamino)ethyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 12703241 |
| Molecular Formula | C20H24ClN5 |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-N-(4-chlorophenyl)-4-N-[2-(diethylamino)ethyl]quinazoline-2,4-diamine |
| SMILES | CCN(CC)CCNc1nc(Nc2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C20H24ClN5/c1-3-26(4-2)14-13-22-19-17-7-5-6-8-18(17)24-20(25-19)23-16-11-9-15(21)10-12-16/h5-12H,3-4,13-14H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | LIRUMJIZIIVMRD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |