C20H22ClN5O — CID 164613491
2-N-(4-chlorophenyl)-4-N-(2-morpholin-4-ylethyl)quinazoline-2,4-diamine (PubChem CID 164613491) has the molecular formula C20H22ClN5O and a molecular weight of 383.88 g/mol. Its IUPAC name is 2-N-(4-chlorophenyl)-4-N-(2-morpholin-4-ylethyl)quinazoline-2,4-diamine.
| Compound Name | 2-N-(4-chlorophenyl)-4-N-(2-morpholin-4-ylethyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 164613491 |
| Molecular Formula | C20H22ClN5O |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-N-(4-chlorophenyl)-4-N-(2-morpholin-4-ylethyl)quinazoline-2,4-diamine |
| SMILES | Clc1ccc(Nc2nc(NCCN3CCOCC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C20H22ClN5O/c21-15-5-7-16(8-6-15)23-20-24-18-4-2-1-3-17(18)19(25-20)22-9-10-26-11-13-27-14-12-26/h1-8H,9-14H2,(H2,22,23,24,25) |
| InChIKey | OIYZHBHBHRMCTG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |