C22H34N6 — CID 66904247
2-N,4-N-bis(2-piperidin-1-ylethyl)quinazoline-2,4-diamine (PubChem CID 66904247) has the molecular formula C22H34N6 and a molecular weight of 382.56 g/mol. Its IUPAC name is 2-N,4-N-bis(2-piperidin-1-ylethyl)quinazoline-2,4-diamine.
| Compound Name | 2-N,4-N-bis(2-piperidin-1-ylethyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 66904247 |
| Molecular Formula | C22H34N6 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | 2-N,4-N-bis(2-piperidin-1-ylethyl)quinazoline-2,4-diamine |
| SMILES | c1ccc2c(NCCN3CCCCC3)nc(NCCN3CCCCC3)nc2c1 |
| InChI | InChI=1S/C22H34N6/c1-5-13-27(14-6-1)17-11-23-21-19-9-3-4-10-20(19)25-22(26-21)24-12-18-28-15-7-2-8-16-28/h3-4,9-10H,1-2,5-8,11-18H2,(H2,23,24,25,26) |
| InChIKey | NACABLJJLGCEAZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |