C22H25Cl2N5 — CID 12703339
4-N-(3,5-dichlorophenyl)-2-N-(3-piperidin-1-ylpropyl)quinazoline-2,4-diamine (PubChem CID 12703339) has the molecular formula C22H25Cl2N5 and a molecular weight of 430.38 g/mol. Its IUPAC name is 4-N-(3,5-dichlorophenyl)-2-N-(3-piperidin-1-ylpropyl)quinazoline-2,4-diamine.
| Compound Name | 4-N-(3,5-dichlorophenyl)-2-N-(3-piperidin-1-ylpropyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 12703339 |
| Molecular Formula | C22H25Cl2N5 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 4-N-(3,5-dichlorophenyl)-2-N-(3-piperidin-1-ylpropyl)quinazoline-2,4-diamine |
| SMILES | Clc1cc(Cl)cc(Nc2nc(NCCCN3CCCCC3)nc3ccccc23)c1 |
| InChI | InChI=1S/C22H25Cl2N5/c23-16-13-17(24)15-18(14-16)26-21-19-7-2-3-8-20(19)27-22(28-21)25-9-6-12-29-10-4-1-5-11-29/h2-3,7-8,13-15H,1,4-6,9-12H2,(H2,25,26,27,28) |
| InChIKey | DXSHUZCHVWFSGP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|