C14H19N3S — CID 66355718
N-(3-pyrrolidin-1-ylpropyl)-2,1-benzothiazol-3-amine (PubChem CID 66355718) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N-(3-pyrrolidin-1-ylpropyl)-2,1-benzothiazol-3-amine.
| Compound Name | N-(3-pyrrolidin-1-ylpropyl)-2,1-benzothiazol-3-amine |
|---|---|
| PubChem CID | 66355718 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-(3-pyrrolidin-1-ylpropyl)-2,1-benzothiazol-3-amine |
| SMILES | c1ccc2c(NCCCN3CCCC3)snc2c1 |
| InChI | InChI=1S/C14H19N3S/c1-2-7-13-12(6-1)14(18-16-13)15-8-5-11-17-9-3-4-10-17/h1-2,6-7,15H,3-5,8-11H2 |
| InChIKey | XZZYCPQPGGSBJQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|