C12H16N2OS — CID 107302591
5-(2,1-benzothiazol-3-ylamino)pentan-1-ol (PubChem CID 107302591) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 5-(2,1-benzothiazol-3-ylamino)pentan-1-ol.
| Compound Name | 5-(2,1-benzothiazol-3-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 107302591 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 5-(2,1-benzothiazol-3-ylamino)pentan-1-ol |
| SMILES | OCCCCCNc1snc2ccccc12 |
| InChI | InChI=1S/C12H16N2OS/c15-9-5-1-4-8-13-12-10-6-2-3-7-11(10)14-16-12/h2-3,6-7,13,15H,1,4-5,8-9H2 |
| InChIKey | RUSRXFXILYIFRD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|