C15H14N2S2 — CID 63373114
N-(2-phenylsulfanylethyl)-2,1-benzothiazol-3-amine (PubChem CID 63373114) has the molecular formula C15H14N2S2 and a molecular weight of 286.43 g/mol. Its IUPAC name is N-(2-phenylsulfanylethyl)-2,1-benzothiazol-3-amine.
| Compound Name | N-(2-phenylsulfanylethyl)-2,1-benzothiazol-3-amine |
|---|---|
| PubChem CID | 63373114 |
| Molecular Formula | C15H14N2S2 |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | N-(2-phenylsulfanylethyl)-2,1-benzothiazol-3-amine |
| SMILES | c1ccc(SCCNc2snc3ccccc23)cc1 |
| InChI | InChI=1S/C15H14N2S2/c1-2-6-12(7-3-1)18-11-10-16-15-13-8-4-5-9-14(13)17-19-15/h1-9,16H,10-11H2 |
| InChIKey | GTULIZVGQVVGBP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|