About N-(3-propoxypropyl)-2,1-benzothiazol-3-amine
N-(3-propoxypropyl)-2,1-benzothiazol-3-amine (PubChem CID 82943856) has the molecular formula C13H18N2OS
and a molecular weight of 250.37 g/mol. Its IUPAC name is N-(3-propoxypropyl)-2,1-benzothiazol-3-amine.
Molecular Properties
| Compound Name | N-(3-propoxypropyl)-2,1-benzothiazol-3-amine |
| PubChem CID | 82943856 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-(3-propoxypropyl)-2,1-benzothiazol-3-amine |
| SMILES | CCCOCCCNc1snc2ccccc12 |
| InChI | InChI=1S/C13H18N2OS/c1-2-9-16-10-5-8-14-13-11-6-3-4-7-12(11)15-17-13/h3-4,6-7,14H,2,5,8-10H2,1H3 |
| InChIKey | VUNQCKWKNXZRQP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-propoxypropyl)-2,1-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-propoxypropyl)-2,1-benzothiazol-3-amine?
The IUPAC name of N-(3-propoxypropyl)-2,1-benzothiazol-3-amine (CID 82943856) is N-(3-propoxypropyl)-2,1-benzothiazol-3-amine.
What is the SMILES notation for N-(3-propoxypropyl)-2,1-benzothiazol-3-amine?
The canonical SMILES for N-(3-propoxypropyl)-2,1-benzothiazol-3-amine is CCCOCCCNc1snc2ccccc12.
What is the InChIKey of N-(3-propoxypropyl)-2,1-benzothiazol-3-amine?
The InChIKey is VUNQCKWKNXZRQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2OS/c1-2-9-16-10-5-8-14-13-11-6-3-4-7-12(11)15-17-13/h3-4,6-7,14H,2,5,8-10H2,1H3.
What are the key properties of N-(3-propoxypropyl)-2,1-benzothiazol-3-amine?
N-(3-propoxypropyl)-2,1-benzothiazol-3-amine has a molecular weight of 250.37 g/mol, XLogP of 3.52, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-propoxypropyl)-2,1-benzothiazol-3-amine is sourced from PubChem (CID 82943856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).