C12H16N2O2S — CID 113362580
2-[3-(2,1-benzothiazol-3-ylamino)propoxy]ethanol (PubChem CID 113362580) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-[3-(2,1-benzothiazol-3-ylamino)propoxy]ethanol.
| Compound Name | 2-[3-(2,1-benzothiazol-3-ylamino)propoxy]ethanol |
|---|---|
| PubChem CID | 113362580 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-[3-(2,1-benzothiazol-3-ylamino)propoxy]ethanol |
| SMILES | OCCOCCCNc1snc2ccccc12 |
| InChI | InChI=1S/C12H16N2O2S/c15-7-9-16-8-3-6-13-12-10-4-1-2-5-11(10)14-17-12/h1-2,4-5,13,15H,3,6-9H2 |
| InChIKey | UKPGNRDHEBTORH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|