C9H9ClN2S — CID 66354488
N-(2-chloroethyl)-2,1-benzothiazol-3-amine (PubChem CID 66354488) has the molecular formula C9H9ClN2S and a molecular weight of 212.71 g/mol. Its IUPAC name is N-(2-chloroethyl)-2,1-benzothiazol-3-amine.
| Compound Name | N-(2-chloroethyl)-2,1-benzothiazol-3-amine |
|---|---|
| PubChem CID | 66354488 |
| Molecular Formula | C9H9ClN2S |
| Molecular Weight | 212.71 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | N-(2-chloroethyl)-2,1-benzothiazol-3-amine |
| SMILES | ClCCNc1snc2ccccc12 |
| InChI | InChI=1S/C9H9ClN2S/c10-5-6-11-9-7-3-1-2-4-8(7)12-13-9/h1-4,11H,5-6H2 |
| InChIKey | BKBPAKVNBUOKPG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.71 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|