About N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine
N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine (PubChem CID 66354694) has the molecular formula C11H13ClN2S
and a molecular weight of 240.76 g/mol. Its IUPAC name is N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine.
Molecular Properties
| Compound Name | N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine |
| PubChem CID | 66354694 |
| Molecular Formula | C11H13ClN2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine |
| SMILES | CC(C)(CCl)Nc1snc2ccccc12 |
| InChI | InChI=1S/C11H13ClN2S/c1-11(2,7-12)13-10-8-5-3-4-6-9(8)14-15-10/h3-6,13H,7H2,1-2H3 |
| InChIKey | ICSKTWYXIPCLHQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine?
The IUPAC name of N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine (CID 66354694) is N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine.
What is the SMILES notation for N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine?
The canonical SMILES for N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine is CC(C)(CCl)Nc1snc2ccccc12.
What is the InChIKey of N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine?
The InChIKey is ICSKTWYXIPCLHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2S/c1-11(2,7-12)13-10-8-5-3-4-6-9(8)14-15-10/h3-6,13H,7H2,1-2H3.
What are the key properties of N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine?
N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine has a molecular weight of 240.76 g/mol, XLogP of 3.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-chloro-2-methylpropan-2-yl)-2,1-benzothiazol-3-amine is sourced from PubChem (CID 66354694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).