C10H7Cl3N2OS — CID 13497334
2,2,2-trichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide (PubChem CID 13497334) has the molecular formula C10H7Cl3N2OS and a molecular weight of 309.61 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 13497334 |
| Molecular Formula | C10H7Cl3N2OS |
| Molecular Weight | 309.61 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | 2,2,2-trichloro-N-(5-methyl-2,1-benzothiazol-3-yl)acetamide |
| SMILES | Cc1ccc2nsc(NC(=O)C(Cl)(Cl)Cl)c2c1 |
| InChI | InChI=1S/C10H7Cl3N2OS/c1-5-2-3-7-6(4-5)8(17-15-7)14-9(16)10(11,12)13/h2-4H,1H3,(H,14,16) |
| InChIKey | WNZQPKSYFLJLML-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.61 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|