C9H7ClN2OS — CID 15586288
N-(5-chloro-2,1-benzothiazol-3-yl)acetamide (PubChem CID 15586288) has the molecular formula C9H7ClN2OS and a molecular weight of 226.69 g/mol. Its IUPAC name is N-(5-chloro-2,1-benzothiazol-3-yl)acetamide.
| Compound Name | N-(5-chloro-2,1-benzothiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 15586288 |
| Molecular Formula | C9H7ClN2OS |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | N-(5-chloro-2,1-benzothiazol-3-yl)acetamide |
| SMILES | CC(=O)Nc1snc2ccc(Cl)cc12 |
| InChI | InChI=1S/C9H7ClN2OS/c1-5(13)11-9-7-4-6(10)2-3-8(7)12-14-9/h2-4H,1H3,(H,11,13) |
| InChIKey | NDQCLZBDMKRDBW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |