C10H13N3S — CID 66356346
N'-(2,1-benzothiazol-3-yl)propane-1,3-diamine (PubChem CID 66356346) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is N'-(2,1-benzothiazol-3-yl)propane-1,3-diamine.
| Compound Name | N'-(2,1-benzothiazol-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 66356346 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N'-(2,1-benzothiazol-3-yl)propane-1,3-diamine |
| SMILES | NCCCNc1snc2ccccc12 |
| InChI | InChI=1S/C10H13N3S/c11-6-3-7-12-10-8-4-1-2-5-9(8)13-14-10/h1-2,4-5,12H,3,6-7,11H2 |
| InChIKey | JZAWWEFFYSJVDT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|