C20H14Cl2N4 — CID 71690550
2-N-(3,5-dichlorophenyl)-4-N-phenylquinazoline-2,4-diamine (PubChem CID 71690550) has the molecular formula C20H14Cl2N4 and a molecular weight of 381.27 g/mol. Its IUPAC name is 2-N-(3,5-dichlorophenyl)-4-N-phenylquinazoline-2,4-diamine.
| Compound Name | 2-N-(3,5-dichlorophenyl)-4-N-phenylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 71690550 |
| Molecular Formula | C20H14Cl2N4 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 2-N-(3,5-dichlorophenyl)-4-N-phenylquinazoline-2,4-diamine |
| SMILES | Clc1cc(Cl)cc(Nc2nc(Nc3ccccc3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C20H14Cl2N4/c21-13-10-14(22)12-16(11-13)24-20-25-18-9-5-4-8-17(18)19(26-20)23-15-6-2-1-3-7-15/h1-12H,(H2,23,24,25,26) |
| InChIKey | BHWJDVSDWJQNED-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |