C17H13ClN6 — CID 155562073
4-N-(3-chlorophenyl)-2-N-(1H-pyrazol-4-yl)quinazoline-2,4-diamine (PubChem CID 155562073) has the molecular formula C17H13ClN6 and a molecular weight of 336.79 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-2-N-(1H-pyrazol-4-yl)quinazoline-2,4-diamine.
| Compound Name | 4-N-(3-chlorophenyl)-2-N-(1H-pyrazol-4-yl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 155562073 |
| Molecular Formula | C17H13ClN6 |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 4-N-(3-chlorophenyl)-2-N-(1H-pyrazol-4-yl)quinazoline-2,4-diamine |
| SMILES | Clc1cccc(Nc2nc(Nc3cn[nH]c3)nc3ccccc23)c1 |
| InChI | InChI=1S/C17H13ClN6/c18-11-4-3-5-12(8-11)21-16-14-6-1-2-7-15(14)23-17(24-16)22-13-9-19-20-10-13/h1-10H,(H,19,20)(H2,21,22,23,24) |
| InChIKey | WOAWRPMGRCGNEB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |