C19H19Cl2N5 — CID 134109487
2-N-(3,5-dichlorophenyl)-4-N-piperidin-4-ylquinazoline-2,4-diamine (PubChem CID 134109487) has the molecular formula C19H19Cl2N5 and a molecular weight of 388.30 g/mol. Its IUPAC name is 2-N-(3,5-dichlorophenyl)-4-N-piperidin-4-ylquinazoline-2,4-diamine.
| Compound Name | 2-N-(3,5-dichlorophenyl)-4-N-piperidin-4-ylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 134109487 |
| Molecular Formula | C19H19Cl2N5 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-N-(3,5-dichlorophenyl)-4-N-piperidin-4-ylquinazoline-2,4-diamine |
| SMILES | Clc1cc(Cl)cc(Nc2nc(NC3CCNCC3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C19H19Cl2N5/c20-12-9-13(21)11-15(10-12)24-19-25-17-4-2-1-3-16(17)18(26-19)23-14-5-7-22-8-6-14/h1-4,9-11,14,22H,5-8H2,(H2,23,24,25,26) |
| InChIKey | KUKIEHZUCCGXHN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |