C21H20ClN5 — CID 134115945
2-chloro-4-[[4-(cyclohexylamino)quinazolin-2-yl]amino]benzonitrile (PubChem CID 134115945) has the molecular formula C21H20ClN5 and a molecular weight of 377.88 g/mol. Its IUPAC name is 2-chloro-4-[[4-(cyclohexylamino)quinazolin-2-yl]amino]benzonitrile.
| Compound Name | 2-chloro-4-[[4-(cyclohexylamino)quinazolin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 134115945 |
| Molecular Formula | C21H20ClN5 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-chloro-4-[[4-(cyclohexylamino)quinazolin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nc(NC3CCCCC3)c3ccccc3n2)cc1Cl |
| InChI | InChI=1S/C21H20ClN5/c22-18-12-16(11-10-14(18)13-23)25-21-26-19-9-5-4-8-17(19)20(27-21)24-15-6-2-1-3-7-15/h4-5,8-12,15H,1-3,6-7H2,(H2,24,25,26,27) |
| InChIKey | YJQRANKLLXGESM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |