C26H34N6O2 — CID 59213424
N-(2-morpholin-4-ylethyl)-2-[2-(2-morpholin-4-ylethylamino)phenyl]quinazolin-4-amine (PubChem CID 59213424) has the molecular formula C26H34N6O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-2-[2-(2-morpholin-4-ylethylamino)phenyl]quinazolin-4-amine.
| Compound Name | N-(2-morpholin-4-ylethyl)-2-[2-(2-morpholin-4-ylethylamino)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 59213424 |
| Molecular Formula | C26H34N6O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-2-[2-(2-morpholin-4-ylethylamino)phenyl]quinazolin-4-amine |
| SMILES | c1ccc(-c2nc(NCCN3CCOCC3)c3ccccc3n2)c(NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C26H34N6O2/c1-3-7-23(27-9-11-31-13-17-33-18-14-31)21(5-1)26-29-24-8-4-2-6-22(24)25(30-26)28-10-12-32-15-19-34-20-16-32/h1-8,27H,9-20H2,(H,28,29,30) |
| InChIKey | HNGUCTLPSICPAN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |