C26H33N5O — CID 25204115
7-(1-methylpiperidin-4-yl)-N-(2-morpholin-4-ylethyl)-2-phenylquinazolin-4-amine (PubChem CID 25204115) has the molecular formula C26H33N5O and a molecular weight of 431.58 g/mol. Its IUPAC name is 7-(1-methylpiperidin-4-yl)-N-(2-morpholin-4-ylethyl)-2-phenylquinazolin-4-amine.
| Compound Name | 7-(1-methylpiperidin-4-yl)-N-(2-morpholin-4-ylethyl)-2-phenylquinazolin-4-amine |
|---|---|
| PubChem CID | 25204115 |
| Molecular Formula | C26H33N5O |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 7-(1-methylpiperidin-4-yl)-N-(2-morpholin-4-ylethyl)-2-phenylquinazolin-4-amine |
| SMILES | CN1CCC(c2ccc3c(NCCN4CCOCC4)nc(-c4ccccc4)nc3c2)CC1 |
| InChI | InChI=1S/C26H33N5O/c1-30-12-9-20(10-13-30)22-7-8-23-24(19-22)28-25(21-5-3-2-4-6-21)29-26(23)27-11-14-31-15-17-32-18-16-31/h2-8,19-20H,9-18H2,1H3,(H,27,28,29) |
| InChIKey | FFWGYCBGGGPMGJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |