C22H26N4O3 — CID 171352054
6-methoxy-2-(4-methoxyphenyl)-N-(2-morpholin-4-ylethyl)quinazolin-4-amine (PubChem CID 171352054) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 6-methoxy-2-(4-methoxyphenyl)-N-(2-morpholin-4-ylethyl)quinazolin-4-amine.
| Compound Name | 6-methoxy-2-(4-methoxyphenyl)-N-(2-morpholin-4-ylethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 171352054 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 6-methoxy-2-(4-methoxyphenyl)-N-(2-morpholin-4-ylethyl)quinazolin-4-amine |
| SMILES | COc1ccc(-c2nc(NCCN3CCOCC3)c3cc(OC)ccc3n2)cc1 |
| InChI | InChI=1S/C22H26N4O3/c1-27-17-5-3-16(4-6-17)21-24-20-8-7-18(28-2)15-19(20)22(25-21)23-9-10-26-11-13-29-14-12-26/h3-8,15H,9-14H2,1-2H3,(H,23,24,25) |
| InChIKey | BJKKICWBMCUTTG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |