C15H20N4O2 — CID 62407799
4-[2-(diethylamino)ethylamino]quinazoline-2-carboxylic acid (PubChem CID 62407799) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-[2-(diethylamino)ethylamino]quinazoline-2-carboxylic acid.
| Compound Name | 4-[2-(diethylamino)ethylamino]quinazoline-2-carboxylic acid |
|---|---|
| PubChem CID | 62407799 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 4-[2-(diethylamino)ethylamino]quinazoline-2-carboxylic acid |
| SMILES | CCN(CC)CCNc1nc(C(=O)O)nc2ccccc12 |
| InChI | InChI=1S/C15H20N4O2/c1-3-19(4-2)10-9-16-13-11-7-5-6-8-12(11)17-14(18-13)15(20)21/h5-8H,3-4,9-10H2,1-2H3,(H,20,21)(H,16,17,18) |
| InChIKey | HTSOOSAFMKAJHP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |