C15H19N3O3 — CID 107853406
4-(6-hydroxyhexylamino)quinazoline-2-carboxylic acid (PubChem CID 107853406) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-(6-hydroxyhexylamino)quinazoline-2-carboxylic acid.
| Compound Name | 4-(6-hydroxyhexylamino)quinazoline-2-carboxylic acid |
|---|---|
| PubChem CID | 107853406 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-(6-hydroxyhexylamino)quinazoline-2-carboxylic acid |
| SMILES | O=C(O)c1nc(NCCCCCCO)c2ccccc2n1 |
| InChI | InChI=1S/C15H19N3O3/c19-10-6-2-1-5-9-16-13-11-7-3-4-8-12(11)17-14(18-13)15(20)21/h3-4,7-8,19H,1-2,5-6,9-10H2,(H,20,21)(H,16,17,18) |
| InChIKey | SDGAPBGFUFVKDF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|