C16H20N2O3 — CID 107853405
4-(6-hydroxyhexylamino)quinoline-3-carboxylic acid (PubChem CID 107853405) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-(6-hydroxyhexylamino)quinoline-3-carboxylic acid.
| Compound Name | 4-(6-hydroxyhexylamino)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 107853405 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-(6-hydroxyhexylamino)quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cnc2ccccc2c1NCCCCCCO |
| InChI | InChI=1S/C16H20N2O3/c19-10-6-2-1-5-9-17-15-12-7-3-4-8-14(12)18-11-13(15)16(20)21/h3-4,7-8,11,19H,1-2,5-6,9-10H2,(H,17,18)(H,20,21) |
| InChIKey | KKBIPMZJEVVGEJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|